| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-5-[(dimethylamino)methyl]triazole-4-carboxamide |
| MolecularFormula | C15H15N9O2Cl2 |
| Smiles | CN(C)Cc1c(C(N/N=C\c(cc2)cc(Cl)c2Cl)=O)nnn1-c1nonc1N |
| InChI | InChI=1S/C15H15Cl2N9O2/c1-25(2)7-11-12(20-24-26(11)14-13(18)22-28-23-14)15(27)21-19-6-8-3-4-9(16)10(17)5-8/h3-6H,7H2,1-2H3,(H2,18,22)(H,21,27) |
| InChIK | NQVIHMRBEXFBQG-UHFFFAOYSA-N |
| TotalMolweight | 424.251 |
| Molweight | 424.251 |
| MonoisotopicMass | 423.072575 |
| CLogP | 2.5843 |
| CLogS | -2.438 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 308.62 |
| Relative PSA | 0.38782 |
| PolarSurfaceArea | 140.35 |
| Druglikeness | 3.5242 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53571 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 4 |
| Symmetricatoms | 1 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 5 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-5-[(dimethylamino)methyl]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-5-[(dimethylamino)methyl]triazole-4-carboxamide