| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-cyclohexylmethylideneamino]-5-(3-nitrophenyl)triazole-4-carboxamide |
| MolecularFormula | C18H19N9O4 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\C2CCCCC2)=O)c1-c1cccc([N+]([O-])=O)c1 |
| InChI | InChI=1S/C18H19N9O4/c19-16-17(24-31-23-16)26-15(12-7-4-8-13(9-12)27(29)30)14(21-25-26)18(28)22-20-10-11-5-2-1-3-6-11/h4,7-11H,1-3,5-6H2,(H2,19,23)(H,22,28) |
| InChIK | NQXZFHGUKLPYFM-UHFFFAOYSA-N |
| TotalMolweight | 425.408 |
| Molweight | 425.408 |
| MonoisotopicMass | 425.156001 |
| CLogP | 2.1134 |
| CLogS | -3.744 |
| H Acceptors | 13 |
| H Donors | 2 |
| TotalSurfaceArea | 320.67 |
| Relative PSA | 0.45704 |
| PolarSurfaceArea | 182.93 |
| Druglikeness | -7.9659 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48387 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 5 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-cyclohexylmethylideneamino]-5-(3-nitrophenyl)triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-cyclohexylmethylideneamino]-5-(3-nitrophenyl)triazole-4-carboxamide