| MolName | 2-benzyl-N,N'-bis[(Z)-thiophen-2-ylmethylideneamino]propanediamide |
| MolecularFormula | C20H18N4O2S2 |
| Smiles | O=C(C(Cc1ccccc1)C(N/N=C\c1cccs1)=O)N/N=C\c1cccs1 |
| InChI | InChI=1S/C20H18N4O2S2/c25-19(23-21-13-16-8-4-10-27-16)18(12-15-6-2-1-3-7-15)20(26)24-22-14-17-9-5-11-28-17/h1-11,13-14,18H,12H2,(H,23,25)(H,24,26) |
| InChIK | NRDSJGHDRIXHOO-UHFFFAOYSA-N |
| TotalMolweight | 410.521 |
| Molweight | 410.521 |
| MonoisotopicMass | 410.087116 |
| CLogP | 4.3862 |
| CLogS | -5.703 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 318.86 |
| Relative PSA | 0.35357 |
| PolarSurfaceArea | 139.4 |
| Druglikeness | 6.9357 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53571 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 2 |
| Symmetricatoms | 12 |
| StereoCon |
Click to Load Molecule:
1 - 2-benzyl-N,N'-bis[(Z)-thiophen-2-ylmethylideneamino]propanediamide | 2 - 2-benzyl-N,N'-bis[(Z)-thiophen-2-ylmethylideneamino]propanediamide