| MolName | N-[(Z)-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]naphthalen-2-amine |
| MolecularFormula | C22H16N4S |
| Smiles | C(c1c(-c2ccccc2)nc2sccn12)=N\Nc1cc2ccccc2cc1 |
| InChI | InChI=1S/C22H16N4S/c1-2-7-17(8-3-1)21-20(26-12-13-27-22(26)24-21)15-23-25-19-11-10-16-6-4-5-9-18(16)14-19/h1-15,25H |
| InChIK | NRIGIKULVRVSRM-UHFFFAOYSA-N |
| TotalMolweight | 368.463 |
| Molweight | 368.463 |
| MonoisotopicMass | 368.109566 |
| CLogP | 6.9127 |
| CLogS | -5.308 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 283.55 |
| Relative PSA | 0.21954 |
| PolarSurfaceArea | 69.93 |
| Druglikeness | 3.8393 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 24 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]naphthalen-2-amine | 2 - N-[(Z)-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]naphthalen-2-amine