| MolName | 3,5-dichloro-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]pyridin-4-amine |
| MolecularFormula | C12H7N3Cl4 |
| Smiles | Clc1cccc(Cl)c1/C=N\Nc(c(Cl)cnc1)c1Cl |
| InChI | InChI=1S/C12H7Cl4N3/c13-8-2-1-3-9(14)7(8)4-18-19-12-10(15)5-17-6-11(12)16/h1-6H,(H,17,19) |
| InChIK | NRQUAVYOAZGFFD-UHFFFAOYSA-N |
| TotalMolweight | 335.021 |
| Molweight | 335.021 |
| MonoisotopicMass | 332.939405 |
| CLogP | 6.264 |
| CLogS | -5.298 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 229.68 |
| Relative PSA | 0.14777 |
| PolarSurfaceArea | 37.28 |
| Druglikeness | 2.3845 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.57895 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3,5-dichloro-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]pyridin-4-amine | 2 - 3,5-dichloro-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]pyridin-4-amine