| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)-N-[(Z)-(4-nitrophenyl)methylideneamino]triazole-4-carboxamide |
| MolecularFormula | C22H20N10O4 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cc2)ccc2[N+]([O-])=O)=O)c1CN(CCC1)c2c1cccc2 |
| InChI | InChI=1S/C22H20N10O4/c23-20-21(28-36-27-20)31-18(13-30-11-3-5-15-4-1-2-6-17(15)30)19(25-29-31)22(33)26-24-12-14-7-9-16(10-8-14)32(34)35/h1-2,4,6-10,12H,3,5,11,13H2,(H2,23,27)(H,26,33) |
| InChIK | NRZUFDNZGHCZEI-UHFFFAOYSA-N |
| TotalMolweight | 488.467 |
| Molweight | 488.467 |
| MonoisotopicMass | 488.1669 |
| CLogP | 2.6217 |
| CLogS | -3.89 |
| H Acceptors | 14 |
| H Donors | 2 |
| TotalSurfaceArea | 364.47 |
| Relative PSA | 0.41186 |
| PolarSurfaceArea | 186.17 |
| Druglikeness | -2.5771 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 5 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)-N-[(Z)-(4-nitrophenyl)methylideneamino]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)-N-[(Z)-(4-nitrophenyl)methylideneamino]triazole-4-carboxamide