| MolName | [(Z)-(2-aminophenyl)methylideneamino]urea |
| MolecularFormula | C8H10N4O |
| Smiles | NC(N/N=C\c(cccc1)c1N)=O |
| InChI | InChI=1S/C8H10N4O/c9-7-4-2-1-3-6(7)5-11-12-8(10)13/h1-5H,9H2,(H3,10,12,13) |
| InChIK | NSQMYBUUSJVJBK-UHFFFAOYSA-N |
| TotalMolweight | 178.194 |
| Molweight | 178.194 |
| MonoisotopicMass | 178.085461 |
| CLogP | 0.458 |
| CLogS | -2.89 |
| H Acceptors | 5 |
| H Donors | 3 |
| TotalSurfaceArea | 144.27 |
| Relative PSA | 0.46129 |
| PolarSurfaceArea | 93.5 |
| Druglikeness | 4.2967 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 13 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 2 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Amides | 1 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-(2-aminophenyl)methylideneamino]urea | 2 - [(Z)-(2-aminophenyl)methylideneamino]urea