| MolName | [4-[(Z)-[[2-[(4-chlorophenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| MolecularFormula | C22H16N3O5Cl3S |
| Smiles | O=C(CNS(c(cc1)ccc1Cl)(=O)=O)N/N=C\c(cc1)ccc1OC(c(ccc(Cl)c1)c1Cl)=O |
| InChI | InChI=1S/C22H16Cl3N3O5S/c23-15-3-8-18(9-4-15)34(31,32)27-13-21(29)28-26-12-14-1-6-17(7-2-14)33-22(30)19-10-5-16(24)11-20(19)25/h1-12,27H,13H2,(H,28,29) |
| InChIK | NSVJOTRMJVVUHP-UHFFFAOYSA-N |
| TotalMolweight | 540.81 |
| Molweight | 540.81 |
| MonoisotopicMass | 538.987623 |
| CLogP | 5.2204 |
| CLogS | -6.714 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 374.56 |
| Relative PSA | 0.26455 |
| PolarSurfaceArea | 122.31 |
| Druglikeness | 8.4551 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67647 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-[(4-chlorophenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate | 2 - [4-[(Z)-[[2-[(4-chlorophenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate