| MolName | 1-(2-fluorophenyl)-3-[(Z)-(5-morpholin-4-ylfuran-2-yl)methylideneamino]thiourea |
| MolecularFormula | C16H17N4O2FS |
| Smiles | Fc(cccc1)c1NC(N/N=C\c1ccc(N2CCOCC2)o1)=S |
| InChI | InChI=1S/C16H17FN4O2S/c17-13-3-1-2-4-14(13)19-16(24)20-18-11-12-5-6-15(23-12)21-7-9-22-10-8-21/h1-6,11H,7-10H2,(H2,19,20,24) |
| InChIK | NTEQQDFQKRHAEQ-UHFFFAOYSA-N |
| TotalMolweight | 348.401 |
| Molweight | 348.401 |
| MonoisotopicMass | 348.105624 |
| CLogP | 2.9021 |
| CLogS | -4.945 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 271.29 |
| Relative PSA | 0.33208 |
| PolarSurfaceArea | 94.12 |
| Druglikeness | 4.0719 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-(2-fluorophenyl)-3-[(Z)-(5-morpholin-4-ylfuran-2-yl)methylideneamino]thiourea | 2 - 1-(2-fluorophenyl)-3-[(Z)-(5-morpholin-4-ylfuran-2-yl)methylideneamino]thiourea