| MolName | 4-[(Z)-(4-bromophenyl)methylideneamino]-3-(4-fluorophenyl)-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C15H10N4BrFS |
| Smiles | Fc(cc1)ccc1C(N1/N=C\c(cc2)ccc2Br)=NNC1=S |
| InChI | InChI=1S/C15H10BrFN4S/c16-12-5-1-10(2-6-12)9-18-21-14(19-20-15(21)22)11-3-7-13(17)8-4-11/h1-9H,(H,20,22) |
| InChIK | NTGXELXAONSJEG-UHFFFAOYSA-N |
| TotalMolweight | 377.24 |
| Molweight | 377.24 |
| MonoisotopicMass | 375.979355 |
| CLogP | 4.121 |
| CLogS | -5.599 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 246.7 |
| Relative PSA | 0.26765 |
| PolarSurfaceArea | 72.08 |
| Druglikeness | 0.46147 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-(4-bromophenyl)methylideneamino]-3-(4-fluorophenyl)-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-(4-bromophenyl)methylideneamino]-3-(4-fluorophenyl)-1H-1,2,4-triazole-5-thione