| MolName | N-[(Z)-(2-chlorophenyl)methylideneamino]-3-(2,3-diphenylindol-1-yl)propanamide |
| MolecularFormula | C30H24N3OCl |
| Smiles | O=C(CCn(c1c2cccc1)c(-c1ccccc1)c2-c1ccccc1)N/N=C\c(cccc1)c1Cl |
| InChI | InChI=1S/C30H24ClN3O/c31-26-17-9-7-15-24(26)21-32-33-28(35)19-20-34-27-18-10-8-16-25(27)29(22-11-3-1-4-12-22)30(34)23-13-5-2-6-14-23/h1-18,21H,19-20H2,(H,33,35) |
| InChIK | NTLFYSNJNLCPSM-UHFFFAOYSA-N |
| TotalMolweight | 477.994 |
| Molweight | 477.994 |
| MonoisotopicMass | 477.160789 |
| CLogP | 7.3382 |
| CLogS | -8.246 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 373.25 |
| Relative PSA | 0.11488 |
| PolarSurfaceArea | 46.39 |
| Druglikeness | 6.4978 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48571 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chlorophenyl)methylideneamino]-3-(2,3-diphenylindol-1-yl)propanamide | 2 - N-[(Z)-(2-chlorophenyl)methylideneamino]-3-(2,3-diphenylindol-1-yl)propanamide