| MolName | 4-[(Z)-anthracen-9-ylmethylideneamino]-3-(2,4-dichlorophenyl)-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C23H14N4Cl2S |
| Smiles | S=C(NN=C1c(ccc(Cl)c2)c2Cl)N1/N=C\c1c(cccc2)c2cc2ccccc12 |
| InChI | InChI=1S/C23H14Cl2N4S/c24-16-9-10-19(21(25)12-16)22-27-28-23(30)29(22)26-13-20-17-7-3-1-5-14(17)11-15-6-2-4-8-18(15)20/h1-13H,(H,28,30) |
| InChIK | NTOXDXURZCUULB-UHFFFAOYSA-N |
| TotalMolweight | 449.364 |
| Molweight | 449.364 |
| MonoisotopicMass | 448.03162 |
| CLogP | 6.8958 |
| CLogS | -9.135 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 321.76 |
| Relative PSA | 0.20522 |
| PolarSurfaceArea | 72.08 |
| Druglikeness | 3.6145 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.46667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 1 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-anthracen-9-ylmethylideneamino]-3-(2,4-dichlorophenyl)-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-anthracen-9-ylmethylideneamino]-3-(2,4-dichlorophenyl)-1H-1,2,4-triazole-5-thione