| MolName | 3-[(Z)-[[4-[(2Z)-2-[(5-hydroxy-2-nitrophenyl)methylidene]hydrazinyl]phthalazin-1-yl]hydrazinylidene]methyl]-4-nitrophenol |
| MolecularFormula | C22H16N8O6 |
| Smiles | [O-][N+](c(cc1)c(/C=N\Nc(c2ccccc22)nnc2N/N=C\c(cc(cc2)O)c2[N+]([O-])=O)cc1O)=O |
| InChI | InChI=1S/C22H16N8O6/c31-15-5-7-19(29(33)34)13(9-15)11-23-25-21-17-3-1-2-4-18(17)22(28-27-21)26-24-12-14-10-16(32)6-8-20(14)30(35)36/h1-12,31-32H,(H,25,27)(H,26,28) |
| InChIK | NTRJOZTVAXZEPC-UHFFFAOYSA-N |
| TotalMolweight | 488.419 |
| Molweight | 488.419 |
| MonoisotopicMass | 488.119282 |
| CLogP | 5.555 |
| CLogS | -6.42 |
| H Acceptors | 14 |
| H Donors | 4 |
| TotalSurfaceArea | 357.38 |
| Relative PSA | 0.43349 |
| PolarSurfaceArea | 206.66 |
| Druglikeness | -3.1684 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 4 |
| Symmetricatoms | 18 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-[[4-[(2Z)-2-[(5-hydroxy-2-nitrophenyl)methylidene]hydrazinyl]phthalazin-1-yl]hydrazinylidene]methyl]-4-nitrophenol | 2 - 3-[(Z)-[[4-[(2Z)-2-[(5-hydroxy-2-nitrophenyl)methylidene]hydrazinyl]phthalazin-1-yl]hydrazinylidene]methyl]-4-nitrophenol