| MolName | (Z)-1-[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C16H12N4OBrF |
| Smiles | Fc1c(COc(cc2)c(/C=N\n3cnnc3)cc2Br)cccc1 |
| InChI | InChI=1S/C16H12BrFN4O/c17-14-5-6-16(23-9-12-3-1-2-4-15(12)18)13(7-14)8-21-22-10-19-20-11-22/h1-8,10-11H,9H2 |
| InChIK | NULHBMOWKRYMGA-UHFFFAOYSA-N |
| TotalMolweight | 375.2 |
| Molweight | 375.2 |
| MonoisotopicMass | 374.01785 |
| CLogP | 3.4024 |
| CLogS | -6.799 |
| H Acceptors | 5 |
| TotalSurfaceArea | 253 |
| Relative PSA | 0.19889 |
| PolarSurfaceArea | 52.3 |
| Druglikeness | -0.07144 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.56522 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine