| MolName | (Z)-1-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-N-morpholin-4-ylmethanimine |
| MolecularFormula | C15H14N3O4Cl |
| Smiles | [O-][N+](c(cc1)cc(Cl)c1-c1ccc(/C=N\N2CCOCC2)o1)=O |
| InChI | InChI=1S/C15H14ClN3O4/c16-14-9-11(19(20)21)1-3-13(14)15-4-2-12(23-15)10-17-18-5-7-22-8-6-18/h1-4,9-10H,5-8H2 |
| InChIK | NUMYKHIBOLAYSJ-UHFFFAOYSA-N |
| TotalMolweight | 335.746 |
| Molweight | 335.746 |
| MonoisotopicMass | 335.067284 |
| CLogP | 2.1148 |
| CLogS | -4.487 |
| H Acceptors | 7 |
| TotalSurfaceArea | 248.4 |
| Relative PSA | 0.28015 |
| PolarSurfaceArea | 83.79 |
| Druglikeness | 0.24249 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-N-morpholin-4-ylmethanimine | 2 - (Z)-1-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-N-morpholin-4-ylmethanimine