| MolName | N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]benzamide |
| MolecularFormula | C18H19N3O2 |
| Smiles | O=C(c1ccccc1)N/N=C\c(cc1)ccc1N1CCOCC1 |
| InChI | InChI=1S/C18H19N3O2/c22-18(16-4-2-1-3-5-16)20-19-14-15-6-8-17(9-7-15)21-10-12-23-13-11-21/h1-9,14H,10-13H2,(H,20,22) |
| InChIK | NUPFRVYDYOBSRH-UHFFFAOYSA-N |
| TotalMolweight | 309.368 |
| Molweight | 309.368 |
| MonoisotopicMass | 309.147727 |
| CLogP | 2.8706 |
| CLogS | -3.824 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 248.83 |
| Relative PSA | 0.19917 |
| PolarSurfaceArea | 53.93 |
| Druglikeness | 5.1193 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 6 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]benzamide | 2 - N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]benzamide