| MolName | N,N'-bis[(Z)-(4-bromothiophen-2-yl)methylideneamino]octanediamide |
| MolecularFormula | C18H20N4O2Br2S2 |
| Smiles | O=C(CCCCCCC(N/N=C\c1cc(Br)cs1)=O)N/N=C\c1cc(Br)cs1 |
| InChI | InChI=1S/C18H20Br2N4O2S2/c19-13-7-15(27-11-13)9-21-23-17(25)5-3-1-2-4-6-18(26)24-22-10-16-8-14(20)12-28-16/h7-12H,1-6H2,(H,23,25)(H,24,26) |
| InChIK | NUWWDTVIONCWJJ-UHFFFAOYSA-N |
| TotalMolweight | 548.323 |
| Molweight | 548.323 |
| MonoisotopicMass | 545.939438 |
| CLogP | 6.4484 |
| CLogS | -7.426 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 352.66 |
| Relative PSA | 0.31968 |
| PolarSurfaceArea | 139.4 |
| Druglikeness | -8.3386 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.78571 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 11 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 6 |
| Symmetricatoms | 14 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-(4-bromothiophen-2-yl)methylideneamino]octanediamide | 2 - N,N'-bis[(Z)-(4-bromothiophen-2-yl)methylideneamino]octanediamide