| MolName | [1-[(Z)-[(4-phenylmethoxybenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] benzoate |
| MolecularFormula | C32H24N2O4 |
| Smiles | O=C(c(cc1)ccc1OCc1ccccc1)N/N=C\c(c1ccccc1cc1)c1OC(c1ccccc1)=O |
| InChI | InChI=1S/C32H24N2O4/c35-31(25-15-18-27(19-16-25)37-22-23-9-3-1-4-10-23)34-33-21-29-28-14-8-7-11-24(28)17-20-30(29)38-32(36)26-12-5-2-6-13-26/h1-21H,22H2,(H,34,35) |
| InChIK | NVOSEUWNPAOHQF-UHFFFAOYSA-N |
| TotalMolweight | 500.553 |
| Molweight | 500.553 |
| MonoisotopicMass | 500.173608 |
| CLogP | 7.1746 |
| CLogS | -8.138 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 392.62 |
| Relative PSA | 0.17587 |
| PolarSurfaceArea | 76.99 |
| Druglikeness | 3.7857 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57895 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 3 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - [1-[(Z)-[(4-phenylmethoxybenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] benzoate | 2 - [1-[(Z)-[(4-phenylmethoxybenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] benzoate