| MolName | [4-[(Z)-[[3-[(2Z)-2-[[4-(3,5-dinitrobenzoyl)oxyphenyl]methylidene]hydrazinyl]-3-oxopropanoyl]hydrazinylidene]methyl]phenyl] 3,5-dinitrobenzoate |
| MolecularFormula | C31H20N8O14 |
| Smiles | [O-][N+](c1cc(C(Oc2ccc(/C=N\NC(CC(N/N=C\c(cc3)ccc3OC(c3cc([N+]([O-])=O)cc([N+]([O-])=O)c3)=O)=O)=O)cc2)=O)cc([N+]([O-])=O)c1)=O |
| InChI | InChI=1S/C31H20N8O14/c40-28(34-32-16-18-1-5-26(6-2-18)52-30(42)20-9-22(36(44)45)13-23(10-20)37(46)47)15-29(41)35-33-17-19-3-7-27(8-4-19)53-31(43)21-11-24(38(48)49)14-25(12-21)39(50)51/h1-14,16-17H,15H2,(H,34,40)(H,35,41) |
| InChIK | NWNWTGPHJJSJLQ-UHFFFAOYSA-N |
| TotalMolweight | 728.542 |
| Molweight | 728.542 |
| MonoisotopicMass | 728.109902 |
| CLogP | 2.1674 |
| CLogS | -9.168 |
| H Acceptors | 22 |
| H Donors | 2 |
| TotalSurfaceArea | 524.42 |
| Relative PSA | 0.45723 |
| PolarSurfaceArea | 318.8 |
| Druglikeness | -3.8876 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58491 |
| Fragments | 1 |
| Non HAtoms | 53 |
| NonCHAtoms | 22 |
| Electronegative Atoms | 22 |
| Rotatable Bond | 16 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 7 |
| Symmetricatoms | 33 |
| AcidicOxygens | 4 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[3-[(2Z)-2-[[4-(3,5-dinitrobenzoyl)oxyphenyl]methylidene]hydrazinyl]-3-oxopropanoyl]hydrazinylidene]methyl]phenyl] 3,5-dinitrobenzoate | 2 - [4-[(Z)-[[3-[(2Z)-2-[[4-(3,5-dinitrobenzoyl)oxyphenyl]methylidene]hydrazinyl]-3-oxopropanoyl]hydrazinylidene]methyl]phenyl] 3,5-dinitrobenzoate