| MolName | 2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide |
| MolecularFormula | C14H13N5O3 |
| Smiles | O=C(CC(C(N1)=O)=NNC1=O)N/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C14H13N5O3/c20-12(9-11-13(21)16-14(22)19-17-11)18-15-8-4-7-10-5-2-1-3-6-10/h1-8H,9H2,(H,18,20)(H2,16,19,21,22) |
| InChIK | NWROYOQUAYLGCL-UHFFFAOYSA-N |
| TotalMolweight | 299.289 |
| Molweight | 299.289 |
| MonoisotopicMass | 299.10184 |
| CLogP | 0.4919 |
| CLogS | -3.653 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 235.38 |
| Relative PSA | 0.41006 |
| PolarSurfaceArea | 112.02 |
| Druglikeness | 7.0982 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72727 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide | 2 - 2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide