| MolName | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide |
| MolecularFormula | C23H18N6O3S |
| Smiles | [O-][N+](c1cccc(/C=N\NC(CSc2nnc(-c3ccccc3)n2-c2ccccc2)=O)c1)=O |
| InChI | InChI=1S/C23H18N6O3S/c30-21(25-24-15-17-8-7-13-20(14-17)29(31)32)16-33-23-27-26-22(18-9-3-1-4-10-18)28(23)19-11-5-2-6-12-19/h1-15H,16H2,(H,25,30) |
| InChIK | NWTFBYNMONUJFL-UHFFFAOYSA-N |
| TotalMolweight | 458.501 |
| Molweight | 458.501 |
| MonoisotopicMass | 458.116109 |
| CLogP | 3.6102 |
| CLogS | -8.876 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 348.15 |
| Relative PSA | 0.3238 |
| PolarSurfaceArea | 143.29 |
| Druglikeness | 0.30503 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide | 2 - 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide