| MolName | N-[(Z)-(4-bromophenyl)methylideneamino]benzamide |
| MolecularFormula | C14H11N2OBr |
| Smiles | O=C(c1ccccc1)N/N=C\c(cc1)ccc1Br |
| InChI | InChI=1S/C14H11BrN2O/c15-13-8-6-11(7-9-13)10-16-17-14(18)12-4-2-1-3-5-12/h1-10H,(H,17,18) |
| InChIK | NWTGPWLADWVGMZ-UHFFFAOYSA-N |
| TotalMolweight | 303.158 |
| Molweight | 303.158 |
| MonoisotopicMass | 302.005474 |
| CLogP | 3.9268 |
| CLogS | -4.555 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 205.62 |
| Relative PSA | 0.17513 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 2.6787 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72222 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-bromophenyl)methylideneamino]benzamide | 2 - N-[(Z)-(4-bromophenyl)methylideneamino]benzamide