| MolName | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[3,5-dichloro-4-[2-(2-phenoxyethoxy)ethoxy]phenyl]methylideneamino]acetamide |
| MolecularFormula | C21H21N5O4Cl2S |
| Smiles | Nc1nnc(CC(N/N=C\c(cc2Cl)cc(Cl)c2OCCOCCOc2ccccc2)=O)s1 |
| InChI | InChI=1S/C21H21Cl2N5O4S/c22-16-10-14(13-25-26-18(29)12-19-27-28-21(24)33-19)11-17(23)20(16)32-9-7-30-6-8-31-15-4-2-1-3-5-15/h1-5,10-11,13H,6-9,12H2,(H2,24,28)(H,26,29) |
| InChIK | NXAYINKQNMXURV-UHFFFAOYSA-N |
| TotalMolweight | 510.401 |
| Molweight | 510.401 |
| MonoisotopicMass | 509.069129 |
| CLogP | 3.8399 |
| CLogS | -5.63 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 378.37 |
| Relative PSA | 0.32661 |
| PolarSurfaceArea | 149.19 |
| Druglikeness | -5.6896 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72727 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 12 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 8 |
| Symmetricatoms | 5 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[3,5-dichloro-4-[2-(2-phenoxyethoxy)ethoxy]phenyl]methylideneamino]acetamide | 2 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[3,5-dichloro-4-[2-(2-phenoxyethoxy)ethoxy]phenyl]methylideneamino]acetamide