| MolName | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-3-(trifluoromethyl)quinoxalin-2-amine |
| MolecularFormula | C16H9N4Cl2F3 |
| Smiles | FC(c1nc2ccccc2nc1N/N=C\c(ccc(Cl)c1)c1Cl)(F)F |
| InChI | InChI=1S/C16H9Cl2F3N4/c17-10-6-5-9(11(18)7-10)8-22-25-15-14(16(19,20)21)23-12-3-1-2-4-13(12)24-15/h1-8H,(H,24,25) |
| InChIK | NXQOFSCFMTYQOJ-UHFFFAOYSA-N |
| TotalMolweight | 385.175 |
| Molweight | 385.175 |
| MonoisotopicMass | 384.015634 |
| CLogP | 6.7442 |
| CLogS | -5.754 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 261.66 |
| Relative PSA | 0.17163 |
| PolarSurfaceArea | 50.17 |
| Druglikeness | -4.8055 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.56 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-3-(trifluoromethyl)quinoxalin-2-amine | 2 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-3-(trifluoromethyl)quinoxalin-2-amine