| MolName | N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-1,3-benzothiazol-2-amine |
| MolecularFormula | C23H18N4S |
| Smiles | C(c1ccccc1)n1c(cccc2)c2c(/C=N\Nc2nc(cccc3)c3s2)c1 |
| InChI | InChI=1S/C23H18N4S/c1-2-8-17(9-3-1)15-27-16-18(19-10-4-6-12-21(19)27)14-24-26-23-25-20-11-5-7-13-22(20)28-23/h1-14,16H,15H2,(H,25,26) |
| InChIK | NXTZJHJDJQNSQI-UHFFFAOYSA-N |
| TotalMolweight | 382.49 |
| Molweight | 382.49 |
| MonoisotopicMass | 382.125216 |
| CLogP | 7.173 |
| CLogS | -5.094 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 295.86 |
| Relative PSA | 0.20675 |
| PolarSurfaceArea | 70.45 |
| Druglikeness | 4.5803 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-1,3-benzothiazol-2-amine | 2 - N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-1,3-benzothiazol-2-amine