| MolName | N,N'-bis[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]hexanediamide |
| MolecularFormula | C28H24N6O8 |
| Smiles | [O-][N+](c(cccc1)c1-c1ccc(/C=N\NC(CCCCC(N/N=C\c2ccc(-c(cccc3)c3[N+]([O-])=O)o2)=O)=O)o1)=O |
| InChI | InChI=1S/C28H24N6O8/c35-27(31-29-17-19-13-15-25(41-19)21-7-1-3-9-23(21)33(37)38)11-5-6-12-28(36)32-30-18-20-14-16-26(42-20)22-8-2-4-10-24(22)34(39)40/h1-4,7-10,13-18H,5-6,11-12H2,(H,31,35)(H,32,36) |
| InChIK | NXVHYYBIIAVTGZ-UHFFFAOYSA-N |
| TotalMolweight | 572.533 |
| Molweight | 572.533 |
| MonoisotopicMass | 572.165564 |
| CLogP | 4.3906 |
| CLogS | -9.038 |
| H Acceptors | 14 |
| H Donors | 2 |
| TotalSurfaceArea | 442.24 |
| Relative PSA | 0.36424 |
| PolarSurfaceArea | 200.84 |
| Druglikeness | -7.0556 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61905 |
| Fragments | 1 |
| Non HAtoms | 42 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 13 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 6 |
| Symmetricatoms | 21 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]hexanediamide | 2 - N,N'-bis[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]hexanediamide