| MolName | [1-[(Z)-[(3-chlorophenyl)carbamothioylhydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate |
| MolecularFormula | C25H17N3O2Cl2S |
| Smiles | O=C(c(cccc1)c1Cl)Oc1c(/C=N\NC(Nc2cc(Cl)ccc2)=S)c2ccccc2cc1 |
| InChI | InChI=1S/C25H17Cl2N3O2S/c26-17-7-5-8-18(14-17)29-25(33)30-28-15-21-19-9-2-1-6-16(19)12-13-23(21)32-24(31)20-10-3-4-11-22(20)27/h1-15H,(H2,29,30,33) |
| InChIK | NXVLZSSWCHFCSB-UHFFFAOYSA-N |
| TotalMolweight | 494.401 |
| Molweight | 494.401 |
| MonoisotopicMass | 493.041851 |
| CLogP | 7.4291 |
| CLogS | -8.869 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 366.36 |
| Relative PSA | 0.2333 |
| PolarSurfaceArea | 94.81 |
| Druglikeness | 2.0847 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.51515 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [1-[(Z)-[(3-chlorophenyl)carbamothioylhydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate | 2 - [1-[(Z)-[(3-chlorophenyl)carbamothioylhydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate