| MolName | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzamide |
| MolecularFormula | C23H17N3O3S2 |
| Smiles | O=C(c1ccc(CSc2nc(cccc3)c3s2)cc1)N/N=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C23H17N3O3S2/c27-22(26-24-12-16-7-10-19-20(11-16)29-14-28-19)17-8-5-15(6-9-17)13-30-23-25-18-3-1-2-4-21(18)31-23/h1-12H,13-14H2,(H,26,27) |
| InChIK | NYFZWMZCZWDDCK-UHFFFAOYSA-N |
| TotalMolweight | 447.538 |
| Molweight | 447.538 |
| MonoisotopicMass | 447.071132 |
| CLogP | 5.7763 |
| CLogS | -7.697 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 327.56 |
| Relative PSA | 0.32003 |
| PolarSurfaceArea | 126.35 |
| Druglikeness | 4.5396 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64516 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzamide | 2 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzamide