| MolName | N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| MolecularFormula | C17H14N4ClFS |
| Smiles | Fc1cccc(Cl)c1/C=N/Nc1ncnc2c1c(CCCC1)c1s2 |
| InChI | InChI=1S/C17H14ClFN4S/c18-12-5-3-6-13(19)11(12)8-22-23-16-15-10-4-1-2-7-14(10)24-17(15)21-9-20-16/h3,5-6,8-9H,1-2,4,7H2,(H,20,21,23) |
| InChIK | NYIHJOGPCWLRFQ-UHFFFAOYSA-N |
| TotalMolweight | 360.843 |
| Molweight | 360.843 |
| MonoisotopicMass | 360.061171 |
| CLogP | 6.6103 |
| CLogS | -6.888 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 260.61 |
| Relative PSA | 0.25045 |
| PolarSurfaceArea | 78.41 |
| Druglikeness | -2.6657 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54167 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine | 2 - N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine