| MolName | 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[5-chloro-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| MolecularFormula | C31H23N5O3Cl2S |
| Smiles | O=C(COc(cc1)c(/C=N\NC(c(cc2)ccc2-c2csc(Nc3ccccc3)n2)=O)cc1Cl)Nc(cc1)ccc1Cl |
| InChI | InChI=1S/C31H23Cl2N5O3S/c32-23-10-13-26(14-11-23)35-29(39)18-41-28-15-12-24(33)16-22(28)17-34-38-30(40)21-8-6-20(7-9-21)27-19-42-31(37-27)36-25-4-2-1-3-5-25/h1-17,19H,18H2,(H,35,39)(H,36,37)(H,38,40) |
| InChIK | NYJMVZWKKQMSJX-UHFFFAOYSA-N |
| TotalMolweight | 616.528 |
| Molweight | 616.528 |
| MonoisotopicMass | 615.089864 |
| CLogP | 8.0419 |
| CLogS | -9.574 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 456.24 |
| Relative PSA | 0.24833 |
| PolarSurfaceArea | 132.95 |
| Druglikeness | 5.9919 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | limit! thiazol-2-ylamine; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64286 |
| Fragments | 1 |
| Non HAtoms | 42 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 29 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[5-chloro-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide | 2 - 4-(2-anilino-1,3-thiazol-4-yl)-N-[(Z)-[5-chloro-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide