| MolName | [(Z)-[3-[(Z)-hydrazinylidenemethyl]-2-morpholin-4-ylcyclopent-2-en-1-ylidene]-phenylmethyl] benzoate |
| MolecularFormula | C24H25N3O3 |
| Smiles | N/N=C\C(CC/C1=C(\c2ccccc2)/OC(c2ccccc2)=O)=C1N1CCOCC1 |
| InChI | InChI=1S/C24H25N3O3/c25-26-17-20-11-12-21(22(20)27-13-15-29-16-14-27)23(18-7-3-1-4-8-18)30-24(28)19-9-5-2-6-10-19/h1-10,17H,11-16,25H2 |
| InChIK | NYNNXXJCCXAWMM-UHFFFAOYSA-N |
| TotalMolweight | 403.481 |
| Molweight | 403.481 |
| MonoisotopicMass | 403.189592 |
| CLogP | 3.3696 |
| CLogS | -4.072 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 315.75 |
| Relative PSA | 0.2007 |
| PolarSurfaceArea | 77.15 |
| Druglikeness | -0.45547 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.43333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 9 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-[3-[(Z)-hydrazinylidenemethyl]-2-morpholin-4-ylcyclopent-2-en-1-ylidene]-phenylmethyl] benzoate | 2 - [(Z)-[3-[(Z)-hydrazinylidenemethyl]-2-morpholin-4-ylcyclopent-2-en-1-ylidene]-phenylmethyl] benzoate