| MolName | N-[5-[2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| MolecularFormula | C16H12N8O6S |
| Smiles | [O-][N+](c1cccc(/C=N\NC(Cc2nnc(NC(C(NC(N3)=O)=CC3=O)=O)s2)=O)c1)=O |
| InChI | InChI=1S/C16H12N8O6S/c25-11-5-10(18-15(28)19-11)14(27)20-16-23-22-13(31-16)6-12(26)21-17-7-8-2-1-3-9(4-8)24(29)30/h1-5,7H,6H2,(H,21,26)(H,20,23,27)(H2,18,19,25,28) |
| InChIK | NYNOUOOSJWPDRP-UHFFFAOYSA-N |
| TotalMolweight | 444.387 |
| Molweight | 444.387 |
| MonoisotopicMass | 444.060052 |
| CLogP | -0.5245 |
| CLogS | -4.219 |
| H Acceptors | 14 |
| H Donors | 4 |
| TotalSurfaceArea | 316.72 |
| Relative PSA | 0.57537 |
| PolarSurfaceArea | 228.6 |
| Druglikeness | 1.4982 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6129 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 15 |
| Electronegative Atoms | 15 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Amides | 3 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[5-[2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2,4-dioxo-1H-pyrimidine-6-carboxamide | 2 - N-[5-[2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2,4-dioxo-1H-pyrimidine-6-carboxamide