| MolName | N,N'-bis[(Z)-(4-nitrophenyl)methylideneamino]hexanediamide |
| MolecularFormula | C20H20N6O6 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(CCCCC(N/N=C\c(cc2)ccc2[N+]([O-])=O)=O)=O)cc1)=O |
| InChI | InChI=1S/C20H20N6O6/c27-19(23-21-13-15-5-9-17(10-6-15)25(29)30)3-1-2-4-20(28)24-22-14-16-7-11-18(12-8-16)26(31)32/h5-14H,1-4H2,(H,23,27)(H,24,28) |
| InChIK | NYROKVKTVMZWOU-UHFFFAOYSA-N |
| TotalMolweight | 440.415 |
| Molweight | 440.415 |
| MonoisotopicMass | 440.144434 |
| CLogP | 2.5128 |
| CLogS | -6.118 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 343.34 |
| Relative PSA | 0.38696 |
| PolarSurfaceArea | 174.56 |
| Druglikeness | -9.2744 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 11 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 18 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-(4-nitrophenyl)methylideneamino]hexanediamide | 2 - N,N'-bis[(Z)-(4-nitrophenyl)methylideneamino]hexanediamide