| MolName | 4-cyclopentyloxy-N-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]benzamide |
| MolecularFormula | C19H20N2O3 |
| Smiles | O=C(c(cc1)ccc1OC1CCCC1)N/N=C\C=C\c1ccco1 |
| InChI | InChI=1S/C19H20N2O3/c22-19(21-20-13-3-7-16-8-4-14-23-16)15-9-11-18(12-10-15)24-17-5-1-2-6-17/h3-4,7-14,17H,1-2,5-6H2,(H,21,22) |
| InChIK | NZFDMYKAHCXSMG-UHFFFAOYSA-N |
| TotalMolweight | 324.379 |
| Molweight | 324.379 |
| MonoisotopicMass | 324.147393 |
| CLogP | 3.5523 |
| CLogS | -5.017 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 267.22 |
| Relative PSA | 0.22498 |
| PolarSurfaceArea | 63.83 |
| Druglikeness | 2.1312 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70833 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 4-cyclopentyloxy-N-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]benzamide | 2 - 4-cyclopentyloxy-N-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]benzamide