| MolName | N-[(Z)-(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine |
| MolecularFormula | C23H14N5O2ClS |
| Smiles | Clc(c(/C=N\Nc1ncnc2c1c(-c1ccccc1)cs2)cc1c2)nc1cc1c2OCO1 |
| InChI | InChI=1S/C23H14ClN5O2S/c24-21-15(6-14-7-18-19(31-12-30-18)8-17(14)28-21)9-27-29-22-20-16(13-4-2-1-3-5-13)10-32-23(20)26-11-25-22/h1-11H,12H2,(H,25,26,29) |
| InChIK | NZFNHJDTRQYTKC-UHFFFAOYSA-N |
| TotalMolweight | 459.916 |
| Molweight | 459.916 |
| MonoisotopicMass | 459.055672 |
| CLogP | 7.4545 |
| CLogS | -8.638 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 326.1 |
| Relative PSA | 0.29512 |
| PolarSurfaceArea | 109.76 |
| Druglikeness | 2.6117 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53125 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 25 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine | 2 - N-[(Z)-(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine