| MolName | 4-chloro-N-[(Z)-(2-chloro-4-oxopyrido[1,2-a]pyrimidin-3-yl)methylideneamino]benzamide |
| MolecularFormula | C16H10N4O2Cl2 |
| Smiles | O=C(c(cc1)ccc1Cl)N/N=C\C(C(N(C=CC=C1)C1=N1)=O)=C1Cl |
| InChI | InChI=1S/C16H10Cl2N4O2/c17-11-6-4-10(5-7-11)15(23)21-19-9-12-14(18)20-13-3-1-2-8-22(13)16(12)24/h1-9H,(H,21,23) |
| InChIK | NZODTQHDSMEEEQ-UHFFFAOYSA-N |
| TotalMolweight | 361.187 |
| Molweight | 361.187 |
| MonoisotopicMass | 360.01808 |
| CLogP | 1.8433 |
| CLogS | -4.525 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 258.01 |
| Relative PSA | 0.24848 |
| PolarSurfaceArea | 74.13 |
| Druglikeness | 6.5775 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | polar activated DB; twice activated DB; acyl-hydrazone; imine/hydrazone of aldehyde; 3-halo-enone |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Symmetricatoms | 2 |
| Amides | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-N-[(Z)-(2-chloro-4-oxopyrido[1,2-a]pyrimidin-3-yl)methylideneamino]benzamide | 2 - 4-chloro-N-[(Z)-(2-chloro-4-oxopyrido[1,2-a]pyrimidin-3-yl)methylideneamino]benzamide