| MolName | N-[(Z)-[5-(4-sulfamoylphenyl)furan-2-yl]methylideneamino]-2-thiophen-2-ylacetamide |
| MolecularFormula | C17H15N3O4S2 |
| Smiles | NS(c(cc1)ccc1-c1ccc(/C=N\NC(Cc2cccs2)=O)o1)(=O)=O |
| InChI | InChI=1S/C17H15N3O4S2/c18-26(22,23)15-6-3-12(4-7-15)16-8-5-13(24-16)11-19-20-17(21)10-14-2-1-9-25-14/h1-9,11H,10H2,(H,20,21)(H2,18,22,23) |
| InChIK | NZOQVEWKEXNRGN-UHFFFAOYSA-N |
| TotalMolweight | 389.455 |
| Molweight | 389.455 |
| MonoisotopicMass | 389.050397 |
| CLogP | 2.7692 |
| CLogS | -5.055 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 283.24 |
| Relative PSA | 0.40365 |
| PolarSurfaceArea | 151.38 |
| Druglikeness | 9.0357 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 2 |
| Symmetricatoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(4-sulfamoylphenyl)furan-2-yl]methylideneamino]-2-thiophen-2-ylacetamide | 2 - N-[(Z)-[5-(4-sulfamoylphenyl)furan-2-yl]methylideneamino]-2-thiophen-2-ylacetamide