| MolName | 2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(5-methylfuran-2-yl)methylideneamino]acetamide |
| MolecularFormula | C18H18N5O2ClS |
| Smiles | CCn1c(SCC(N/N=C\c2ccc(C)o2)=O)nnc1-c(cc1)ccc1Cl |
| InChI | InChI=1S/C18H18ClN5O2S/c1-3-24-17(13-5-7-14(19)8-6-13)22-23-18(24)27-11-16(25)21-20-10-15-9-4-12(2)26-15/h4-10H,3,11H2,1-2H3,(H,21,25) |
| InChIK | NZXRWUPBVPELJG-UHFFFAOYSA-N |
| TotalMolweight | 403.893 |
| Molweight | 403.893 |
| MonoisotopicMass | 403.086972 |
| CLogP | 3.6508 |
| CLogS | -5.581 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 308.11 |
| Relative PSA | 0.31294 |
| PolarSurfaceArea | 110.61 |
| Druglikeness | 5.8372 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(5-methylfuran-2-yl)methylideneamino]acetamide | 2 - 2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(5-methylfuran-2-yl)methylideneamino]acetamide