| MolName | [2-[(Z)-[2-(2,4-dichlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] benzoate |
| MolecularFormula | C28H17N3O3Cl2 |
| Smiles | O=C(c1ccccc1)Oc1c(/C=N\N(C(c(ccc(Cl)c2)c2Cl)=Nc2c3cccc2)C3=O)cccc1 |
| InChI | InChI=1S/C28H17Cl2N3O3/c29-20-14-15-21(23(30)16-20)26-32-24-12-6-5-11-22(24)27(34)33(26)31-17-19-10-4-7-13-25(19)36-28(35)18-8-2-1-3-9-18/h1-17H |
| InChIK | OAAMEQWQKCNRFT-UHFFFAOYSA-N |
| TotalMolweight | 514.367 |
| Molweight | 514.367 |
| MonoisotopicMass | 513.064696 |
| CLogP | 6.761 |
| CLogS | -7.742 |
| H Acceptors | 6 |
| TotalSurfaceArea | 373.41 |
| Relative PSA | 0.16778 |
| PolarSurfaceArea | 71.33 |
| Druglikeness | 3.5432 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.47222 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[2-(2,4-dichlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] benzoate | 2 - [2-[(Z)-[2-(2,4-dichlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] benzoate