| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide |
| MolecularFormula | C25H18N8O3Cl2 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2cccc(OCc(ccc(Cl)c3)c3Cl)c2)=O)c1-c1ccccc1 |
| InChI | InChI=1S/C25H18Cl2N8O3/c26-18-10-9-17(20(27)12-18)14-37-19-8-4-5-15(11-19)13-29-31-25(36)21-22(16-6-2-1-3-7-16)35(34-30-21)24-23(28)32-38-33-24/h1-13H,14H2,(H2,28,32)(H,31,36) |
| InChIK | OAICQARRQBYKSN-UHFFFAOYSA-N |
| TotalMolweight | 549.377 |
| Molweight | 549.377 |
| MonoisotopicMass | 548.087891 |
| CLogP | 6.0057 |
| CLogS | -6.019 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 403.32 |
| Relative PSA | 0.31275 |
| PolarSurfaceArea | 146.34 |
| Druglikeness | 1.7579 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52632 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide