| MolName | 2-[(Z)-[[2-(2-fluorophenoxy)acetyl]hydrazinylidene]methyl]benzoate |
| MolecularFormula | C16H12N2O4F |
| Smiles | [O-]C(c1c(/C=N\NC(COc(cccc2)c2F)=O)cccc1)=O |
| InChI | InChI=1S/C16H13FN2O4/c17-13-7-3-4-8-14(13)23-10-15(20)19-18-9-11-5-1-2-6-12(11)16(21)22/h1-9H,10H2,(H,19,20)(H,21,22)/p-1 |
| InChIK | OALNEFOBDGCFGR-UHFFFAOYSA-M |
| TotalMolweight | 315.279 |
| Molweight | 315.279 |
| MonoisotopicMass | 315.078111 |
| CLogP | 0.2864 |
| CLogS | -3.828 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 242.38 |
| Relative PSA | 0.30254 |
| PolarSurfaceArea | 90.82 |
| Druglikeness | 2.9064 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6087 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-[[2-(2-fluorophenoxy)acetyl]hydrazinylidene]methyl]benzoate | 2 - 2-[(Z)-[[2-(2-fluorophenoxy)acetyl]hydrazinylidene]methyl]benzoate