| MolName | N-[(Z)-anthracen-9-ylmethylideneamino]-2-(4-bromonaphthalen-1-yl)acetamide |
| MolecularFormula | C27H19N2OBr |
| Smiles | O=C(Cc(c1ccccc11)ccc1Br)N/N=C\c1c(cccc2)c2cc2ccccc12 |
| InChI | InChI=1S/C27H19BrN2O/c28-26-14-13-20(21-9-5-6-12-24(21)26)16-27(31)30-29-17-25-22-10-3-1-7-18(22)15-19-8-2-4-11-23(19)25/h1-15,17H,16H2,(H,30,31) |
| InChIK | OAPMWYNUAWSSAR-UHFFFAOYSA-N |
| TotalMolweight | 467.365 |
| Molweight | 467.365 |
| MonoisotopicMass | 466.068074 |
| CLogP | 7.5081 |
| CLogS | -9.338 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 323.18 |
| Relative PSA | 0.11142 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 2.5805 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48387 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 1 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-anthracen-9-ylmethylideneamino]-2-(4-bromonaphthalen-1-yl)acetamide | 2 - N-[(Z)-anthracen-9-ylmethylideneamino]-2-(4-bromonaphthalen-1-yl)acetamide