| MolName | 5-[(2Z)-2-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-chlorobenzoic acid |
| MolecularFormula | C21H15N2O3BrCl2 |
| Smiles | OC(c(cc(cc1)N/N=C\c(cc(cc2)Br)c2OCc(cccc2)c2Cl)c1Cl)=O |
| InChI | InChI=1S/C21H15BrCl2N2O3/c22-15-5-8-20(29-12-13-3-1-2-4-18(13)23)14(9-15)11-25-26-16-6-7-19(24)17(10-16)21(27)28/h1-11,26H,12H2,(H,27,28) |
| InChIK | OASQKLFGJJPEET-UHFFFAOYSA-N |
| TotalMolweight | 494.171 |
| Molweight | 494.171 |
| MonoisotopicMass | 491.964308 |
| CLogP | 7.6113 |
| CLogS | -6.809 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 326.33 |
| Relative PSA | 0.18114 |
| PolarSurfaceArea | 70.92 |
| Druglikeness | -0.18603 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-[(2Z)-2-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-chlorobenzoic acid | 2 - 5-[(2Z)-2-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-chlorobenzoic acid