| MolName | N-[[(4S)-4-(2-methylphenyl)-2-phenyl-4H-chromen-3-yl]methylideneamino]-5-nitrofuran-2-carboxamide |
| MolecularFormula | C28H21N3O5 |
| Smiles | Cc1c([C@H]2c(cccc3)c3OC(c3ccccc3)=C2C=NNC(c2ccc([N+]([O-])=O)o2)=O)cccc1 |
| InChI | InChI=1S/C28H21N3O5/c1-18-9-5-6-12-20(18)26-21-13-7-8-14-23(21)36-27(19-10-3-2-4-11-19)22(26)17-29-30-28(32)24-15-16-25(35-24)31(33)34/h2-17,26H,1H3,(H,30,32)/t26-/m0/s1 |
| InChIK | OBEBQXKELCDIAN-SANMLTNESA-N |
| TotalMolweight | 479.491 |
| Molweight | 479.491 |
| MonoisotopicMass | 479.148122 |
| CLogP | 4.7397 |
| CLogS | -7.336 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 364.05 |
| Relative PSA | 0.2487 |
| PolarSurfaceArea | 109.65 |
| Druglikeness | 1.6083 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.41667 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| StereoCenters | 1 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - N-[[(4S)-4-(2-methylphenyl)-2-phenyl-4H-chromen-3-yl]methylideneamino]-5-nitrofuran-2-carboxamide | 2 - N-[[(4S)-4-(2-methylphenyl)-2-phenyl-4H-chromen-3-yl]methylideneamino]-5-nitrofuran-2-carboxamide