| MolName | [(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]urea |
| MolecularFormula | C15H17N5O2S |
| Smiles | NC(N/N=C\c1c(-c2ccccc2)nc(N2CCOCC2)s1)=O |
| InChI | InChI=1S/C15H17N5O2S/c16-14(21)19-17-10-12-13(11-4-2-1-3-5-11)18-15(23-12)20-6-8-22-9-7-20/h1-5,10H,6-9H2,(H3,16,19,21) |
| InChIK | OBKCYZHKOZIMMW-UHFFFAOYSA-N |
| TotalMolweight | 331.399 |
| Molweight | 331.399 |
| MonoisotopicMass | 331.110295 |
| CLogP | 2.262 |
| CLogS | -4.538 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 252.05 |
| Relative PSA | 0.38151 |
| PolarSurfaceArea | 121.08 |
| Druglikeness | 6.2359 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.52174 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]urea | 2 - [(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]urea