| MolName | N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-2-pyrrol-1-ylbenzamide |
| MolecularFormula | C22H22N4O2 |
| Smiles | O=C(c(cccc1)c1-n1cccc1)N/N=C\c(cc1)ccc1N1CCOCC1 |
| InChI | InChI=1S/C22H22N4O2/c27-22(20-5-1-2-6-21(20)26-11-3-4-12-26)24-23-17-18-7-9-19(10-8-18)25-13-15-28-16-14-25/h1-12,17H,13-16H2,(H,24,27) |
| InChIK | OBMVOADREKBKJJ-UHFFFAOYSA-N |
| TotalMolweight | 374.443 |
| Molweight | 374.443 |
| MonoisotopicMass | 374.174276 |
| CLogP | 3.0555 |
| CLogS | -6.137 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 297.79 |
| Relative PSA | 0.1895 |
| PolarSurfaceArea | 58.86 |
| Druglikeness | 5.1854 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 5 |
| Symmetricatoms | 6 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-2-pyrrol-1-ylbenzamide | 2 - N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-2-pyrrol-1-ylbenzamide