| MolName | 2-[2-[(Z)-[3-(2,4-dichlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetic acid |
| MolecularFormula | C17H12N4O3Cl2S |
| Smiles | OC(COc1c(/C=N\N(C(c(ccc(Cl)c2)c2Cl)=NN2)C2=S)cccc1)=O |
| InChI | InChI=1S/C17H12Cl2N4O3S/c18-11-5-6-12(13(19)7-11)16-21-22-17(27)23(16)20-8-10-3-1-2-4-14(10)26-9-15(24)25/h1-8H,9H2,(H,22,27)(H,24,25) |
| InChIK | OBSFERPPJRRDHN-UHFFFAOYSA-N |
| TotalMolweight | 423.279 |
| Molweight | 423.279 |
| MonoisotopicMass | 422.000715 |
| CLogP | 3.567 |
| CLogS | -5.716 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 300.42 |
| Relative PSA | 0.34009 |
| PolarSurfaceArea | 118.61 |
| Druglikeness | 3.635 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-[3-(2,4-dichlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetic acid | 2 - 2-[2-[(Z)-[3-(2,4-dichlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetic acid