| MolName | 2-(8-anilino-4-oxa-1,3,5,7,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-12-yl)-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide |
| MolecularFormula | C21H14N10O6 |
| Smiles | [O-][N+](c1c(/C=N\NC(Cc2nnc3n2c2nonc2nc3Nc2ccccc2)=O)cc2OCOc2c1)=O |
| InChI | InChI=1S/C21H14N10O6/c32-17(26-22-9-11-6-14-15(36-10-35-14)7-13(11)31(33)34)8-16-25-27-20-18(23-12-4-2-1-3-5-12)24-19-21(30(16)20)29-37-28-19/h1-7,9H,8,10H2,(H,26,32)(H,23,24,28) |
| InChIK | OCFFAEHDONCAJI-UHFFFAOYSA-N |
| TotalMolweight | 502.406 |
| Molweight | 502.406 |
| MonoisotopicMass | 502.10978 |
| CLogP | 2.0582 |
| CLogS | -8.194 |
| H Acceptors | 16 |
| H Donors | 2 |
| TotalSurfaceArea | 359.24 |
| Relative PSA | 0.48658 |
| PolarSurfaceArea | 199.77 |
| Druglikeness | 0.58667 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51351 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 16 |
| Electronegative Atoms | 16 |
| Rotatable Bond | 7 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 6 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(8-anilino-4-oxa-1,3,5,7,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-12-yl)-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide | 2 - 2-(8-anilino-4-oxa-1,3,5,7,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-12-yl)-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide