| MolName | 2-[[5-cyclopropyl-4-[(Z)-(3-phenoxyphenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]-1-morpholin-4-ylethanone |
| MolecularFormula | C24H25N5O3S |
| Smiles | O=C(CSc1nnc(C2CC2)n1/N=C\c1cc(Oc2ccccc2)ccc1)N1CCOCC1 |
| InChI | InChI=1S/C24H25N5O3S/c30-22(28-11-13-31-14-12-28)17-33-24-27-26-23(19-9-10-19)29(24)25-16-18-5-4-8-21(15-18)32-20-6-2-1-3-7-20/h1-8,15-16,19H,9-14,17H2 |
| InChIK | OCJWDSFTOWIFCL-UHFFFAOYSA-N |
| TotalMolweight | 463.561 |
| Molweight | 463.561 |
| MonoisotopicMass | 463.16781 |
| CLogP | 3.7534 |
| CLogS | -6.869 |
| H Acceptors | 8 |
| TotalSurfaceArea | 351.62 |
| Relative PSA | 0.26847 |
| PolarSurfaceArea | 107.14 |
| Druglikeness | 6.0535 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.57576 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 11 |
| Symmetricatoms | 5 |
| Amides | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[5-cyclopropyl-4-[(Z)-(3-phenoxyphenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]-1-morpholin-4-ylethanone | 2 - 2-[[5-cyclopropyl-4-[(Z)-(3-phenoxyphenyl)methylideneamino]-1,2,4-triazol-3-yl]sulfanyl]-1-morpholin-4-ylethanone