| MolName | [1-[(Z)-[(4-fluorophenyl)carbamothioylhydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
| MolecularFormula | C25H16N3O2Cl2FS |
| Smiles | O=C(c(ccc(Cl)c1)c1Cl)Oc1c(/C=N\NC(Nc(cc2)ccc2F)=S)c2ccccc2cc1 |
| InChI | InChI=1S/C25H16Cl2FN3O2S/c26-16-6-11-20(22(27)13-16)24(32)33-23-12-5-15-3-1-2-4-19(15)21(23)14-29-31-25(34)30-18-9-7-17(28)8-10-18/h1-14H,(H2,30,31,34) |
| InChIK | OCQARFQWWZPFGY-UHFFFAOYSA-N |
| TotalMolweight | 512.391 |
| Molweight | 512.391 |
| MonoisotopicMass | 511.032429 |
| CLogP | 7.5299 |
| CLogS | -9.183 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 372.71 |
| Relative PSA | 0.22932 |
| PolarSurfaceArea | 94.81 |
| Druglikeness | 0.74473 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | low |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [1-[(Z)-[(4-fluorophenyl)carbamothioylhydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate | 2 - [1-[(Z)-[(4-fluorophenyl)carbamothioylhydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate